C17H25BrN2 — CID 63683349
N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-N-methyl-2-(methylaminomethyl)aniline (PubChem CID 63683349) has the molecular formula C17H25BrN2 and a molecular weight of 337.31 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-N-methyl-2-(methylaminomethyl)aniline.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-N-methyl-2-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 63683349 |
| Molecular Formula | C17H25BrN2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-N-methyl-2-(methylaminomethyl)aniline |
| SMILES | CNCc1ccc(Br)cc1N(C)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H25BrN2/c1-19-10-14-5-6-16(18)9-17(14)20(2)11-15-8-12-3-4-13(15)7-12/h5-6,9,12-13,15,19H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | WHYGGEYYFXEGNY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |