C17H16BrFN2 — CID 107533023
2-bromo-4-(2,6-diethylanilino)-3-fluorobenzonitrile (PubChem CID 107533023) has the molecular formula C17H16BrFN2 and a molecular weight of 347.23 g/mol. Its IUPAC name is 2-bromo-4-(2,6-diethylanilino)-3-fluorobenzonitrile.
| Compound Name | 2-bromo-4-(2,6-diethylanilino)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107533023 |
| Molecular Formula | C17H16BrFN2 |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-bromo-4-(2,6-diethylanilino)-3-fluorobenzonitrile |
| SMILES | CCc1cccc(CC)c1Nc1ccc(C#N)c(Br)c1F |
| InChI | InChI=1S/C17H16BrFN2/c1-3-11-6-5-7-12(4-2)17(11)21-14-9-8-13(10-20)15(18)16(14)19/h5-9,21H,3-4H2,1-2H3 |
| InChIKey | HULNFEQCMDZKEE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |