C16H14F2N2 — CID 107933149
4-(2-ethyl-6-methylanilino)-2,3-difluorobenzonitrile (PubChem CID 107933149) has the molecular formula C16H14F2N2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(2-ethyl-6-methylanilino)-2,3-difluorobenzonitrile.
| Compound Name | 4-(2-ethyl-6-methylanilino)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933149 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-(2-ethyl-6-methylanilino)-2,3-difluorobenzonitrile |
| SMILES | CCc1cccc(C)c1Nc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C16H14F2N2/c1-3-11-6-4-5-10(2)16(11)20-13-8-7-12(9-19)14(17)15(13)18/h4-8,20H,3H2,1-2H3 |
| InChIKey | AKPSBNMALONOJB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |