C14H18BrFN2O — CID 107533456
2-bromo-3-fluoro-4-[2-hydroxyethyl(pentan-3-yl)amino]benzonitrile (PubChem CID 107533456) has the molecular formula C14H18BrFN2O and a molecular weight of 329.21 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[2-hydroxyethyl(pentan-3-yl)amino]benzonitrile.
| Compound Name | 2-bromo-3-fluoro-4-[2-hydroxyethyl(pentan-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 107533456 |
| Molecular Formula | C14H18BrFN2O |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-bromo-3-fluoro-4-[2-hydroxyethyl(pentan-3-yl)amino]benzonitrile |
| SMILES | CCC(CC)N(CCO)c1ccc(C#N)c(Br)c1F |
| InChI | InChI=1S/C14H18BrFN2O/c1-3-11(4-2)18(7-8-19)12-6-5-10(9-17)13(15)14(12)16/h5-6,11,19H,3-4,7-8H2,1-2H3 |
| InChIKey | CGRWMSMUIDROGF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |