C13H14BrFN2 — CID 107533918
2-bromo-3-fluoro-4-[prop-2-enyl(propyl)amino]benzonitrile (PubChem CID 107533918) has the molecular formula C13H14BrFN2 and a molecular weight of 297.17 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[prop-2-enyl(propyl)amino]benzonitrile.
| Compound Name | 2-bromo-3-fluoro-4-[prop-2-enyl(propyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107533918 |
| Molecular Formula | C13H14BrFN2 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-bromo-3-fluoro-4-[prop-2-enyl(propyl)amino]benzonitrile |
| SMILES | C=CCN(CCC)c1ccc(C#N)c(Br)c1F |
| InChI | InChI=1S/C13H14BrFN2/c1-3-7-17(8-4-2)11-6-5-10(9-16)12(14)13(11)15/h3,5-6H,1,4,7-8H2,2H3 |
| InChIKey | CNNAHSPAAHLRRG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|