C14H19BrFN3OS — CID 107534845
2-bromo-3-fluoro-4-(1-morpholin-4-ylpropan-2-ylamino)benzenecarbothioamide (PubChem CID 107534845) has the molecular formula C14H19BrFN3OS and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(1-morpholin-4-ylpropan-2-ylamino)benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-(1-morpholin-4-ylpropan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107534845 |
| Molecular Formula | C14H19BrFN3OS |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-bromo-3-fluoro-4-(1-morpholin-4-ylpropan-2-ylamino)benzenecarbothioamide |
| SMILES | CC(CN1CCOCC1)Nc1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C14H19BrFN3OS/c1-9(8-19-4-6-20-7-5-19)18-11-3-2-10(14(17)21)12(15)13(11)16/h2-3,9,18H,4-8H2,1H3,(H2,17,21) |
| InChIKey | PJGQCZNPGOTKMD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|