C15H6BrF3O2 — CID 107538000
(2-bromo-3,4-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanone (PubChem CID 107538000) has the molecular formula C15H6BrF3O2 and a molecular weight of 355.11 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanone.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 107538000 |
| Molecular Formula | C15H6BrF3O2 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanone |
| SMILES | O=C(c1cc2cc(F)ccc2o1)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H6BrF3O2/c16-13-9(2-3-10(18)14(13)19)15(20)12-6-7-5-8(17)1-4-11(7)21-12/h1-6H |
| InChIKey | LNEYLFMSZGGSBZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|