C12H12BrF2N3 — CID 107538743
1-(2-bromo-3,4-difluorophenyl)-2-(1-methylpyrazol-3-yl)ethanamine (PubChem CID 107538743) has the molecular formula C12H12BrF2N3 and a molecular weight of 316.15 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 107538743 |
| Molecular Formula | C12H12BrF2N3 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(1-methylpyrazol-3-yl)ethanamine |
| SMILES | Cn1ccc(CC(N)c2ccc(F)c(F)c2Br)n1 |
| InChI | InChI=1S/C12H12BrF2N3/c1-18-5-4-7(17-18)6-10(16)8-2-3-9(14)12(15)11(8)13/h2-5,10H,6,16H2,1H3 |
| InChIKey | GDUUGAUMHBYJOF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|