C15H15BrFNO2S — CID 107540046
2-bromo-3-fluoro-4-[(2-methyl-1-thiophen-2-ylpropyl)amino]benzoic acid (PubChem CID 107540046) has the molecular formula C15H15BrFNO2S and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[(2-methyl-1-thiophen-2-ylpropyl)amino]benzoic acid.
| Compound Name | 2-bromo-3-fluoro-4-[(2-methyl-1-thiophen-2-ylpropyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107540046 |
| Molecular Formula | C15H15BrFNO2S |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-bromo-3-fluoro-4-[(2-methyl-1-thiophen-2-ylpropyl)amino]benzoic acid |
| SMILES | CC(C)C(Nc1ccc(C(=O)O)c(Br)c1F)c1cccs1 |
| InChI | InChI=1S/C15H15BrFNO2S/c1-8(2)14(11-4-3-7-21-11)18-10-6-5-9(15(19)20)12(16)13(10)17/h3-8,14,18H,1-2H3,(H,19,20) |
| InChIKey | NZIUPDKERMRXND-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |