C14H14BrFN2S2 — CID 107534858
2-bromo-3-fluoro-4-(1-thiophen-2-ylpropylamino)benzenecarbothioamide (PubChem CID 107534858) has the molecular formula C14H14BrFN2S2 and a molecular weight of 373.32 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(1-thiophen-2-ylpropylamino)benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-(1-thiophen-2-ylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107534858 |
| Molecular Formula | C14H14BrFN2S2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 2-bromo-3-fluoro-4-(1-thiophen-2-ylpropylamino)benzenecarbothioamide |
| SMILES | CCC(Nc1ccc(C(N)=S)c(Br)c1F)c1cccs1 |
| InChI | InChI=1S/C14H14BrFN2S2/c1-2-9(11-4-3-7-20-11)18-10-6-5-8(14(17)19)12(15)13(10)16/h3-7,9,18H,2H2,1H3,(H2,17,19) |
| InChIKey | SALVZQOVTSMMHQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|