C13H13F2NS — CID 61076983
2,3-difluoro-N-(1-thiophen-2-ylpropyl)aniline (PubChem CID 61076983) has the molecular formula C13H13F2NS and a molecular weight of 253.32 g/mol. Its IUPAC name is 2,3-difluoro-N-(1-thiophen-2-ylpropyl)aniline.
| Compound Name | 2,3-difluoro-N-(1-thiophen-2-ylpropyl)aniline |
|---|---|
| PubChem CID | 61076983 |
| Molecular Formula | C13H13F2NS |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2,3-difluoro-N-(1-thiophen-2-ylpropyl)aniline |
| SMILES | CCC(Nc1cccc(F)c1F)c1cccs1 |
| InChI | InChI=1S/C13H13F2NS/c1-2-10(12-7-4-8-17-12)16-11-6-3-5-9(14)13(11)15/h3-8,10,16H,2H2,1H3 |
| InChIKey | HLUNBAPLKDVXRK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |