C16H17BrF2N2 — CID 107541299
[(2-bromo-3,4-difluorophenyl)-(2,4,5-trimethylphenyl)methyl]hydrazine (PubChem CID 107541299) has the molecular formula C16H17BrF2N2 and a molecular weight of 355.23 g/mol. Its IUPAC name is [(2-bromo-3,4-difluorophenyl)-(2,4,5-trimethylphenyl)methyl]hydrazine.
| Compound Name | [(2-bromo-3,4-difluorophenyl)-(2,4,5-trimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107541299 |
| Molecular Formula | C16H17BrF2N2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [(2-bromo-3,4-difluorophenyl)-(2,4,5-trimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)c(C(NN)c2ccc(F)c(F)c2Br)cc1C |
| InChI | InChI=1S/C16H17BrF2N2/c1-8-6-10(3)12(7-9(8)2)16(21-20)11-4-5-13(18)15(19)14(11)17/h4-7,16,21H,20H2,1-3H3 |
| InChIKey | VRPSCXZHRZAWSO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|