C12H11BrF2N4O — CID 112747743
[(2-bromo-3,4-difluorophenyl)-(2-methoxypyrimidin-5-yl)methyl]hydrazine (PubChem CID 112747743) has the molecular formula C12H11BrF2N4O and a molecular weight of 345.15 g/mol. Its IUPAC name is [(2-bromo-3,4-difluorophenyl)-(2-methoxypyrimidin-5-yl)methyl]hydrazine.
| Compound Name | [(2-bromo-3,4-difluorophenyl)-(2-methoxypyrimidin-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 112747743 |
| Molecular Formula | C12H11BrF2N4O |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | [(2-bromo-3,4-difluorophenyl)-(2-methoxypyrimidin-5-yl)methyl]hydrazine |
| SMILES | COc1ncc(C(NN)c2ccc(F)c(F)c2Br)cn1 |
| InChI | InChI=1S/C12H11BrF2N4O/c1-20-12-17-4-6(5-18-12)11(19-16)7-2-3-8(14)10(15)9(7)13/h2-5,11,19H,16H2,1H3 |
| InChIKey | DTMPUXTWQSUEOE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|