C12H7ClN4O2 — CID 107542995
3-chloro-4-[(4-cyanopyrimidin-2-yl)amino]benzoic acid (PubChem CID 107542995) has the molecular formula C12H7ClN4O2 and a molecular weight of 274.67 g/mol. Its IUPAC name is 3-chloro-4-[(4-cyanopyrimidin-2-yl)amino]benzoic acid.
| Compound Name | 3-chloro-4-[(4-cyanopyrimidin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 107542995 |
| Molecular Formula | C12H7ClN4O2 |
| Molecular Weight | 274.67 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 3-chloro-4-[(4-cyanopyrimidin-2-yl)amino]benzoic acid |
| SMILES | N#Cc1ccnc(Nc2ccc(C(=O)O)cc2Cl)n1 |
| InChI | InChI=1S/C12H7ClN4O2/c13-9-5-7(11(18)19)1-2-10(9)17-12-15-4-3-8(6-14)16-12/h1-5H,(H,18,19)(H,15,16,17) |
| InChIKey | NSUUWMJIBQFTRZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |