C11H4F2N4O3 — CID 107545938
2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carbonitrile (PubChem CID 107545938) has the molecular formula C11H4F2N4O3 and a molecular weight of 278.17 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carbonitrile.
| Compound Name | 2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545938 |
| Molecular Formula | C11H4F2N4O3 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ccnc(Oc2cc(F)c([N+](=O)[O-])cc2F)n1 |
| InChI | InChI=1S/C11H4F2N4O3/c12-7-4-10(8(13)3-9(7)17(18)19)20-11-15-2-1-6(5-14)16-11/h1-4H |
| InChIKey | JGYYVXXDRWDBOA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 101.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|