C11H7F2N5O3 — CID 107551129
2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carboximidamide (PubChem CID 107551129) has the molecular formula C11H7F2N5O3 and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carboximidamide.
| Compound Name | 2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107551129 |
| Molecular Formula | C11H7F2N5O3 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-(2,5-difluoro-4-nitrophenoxy)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(Oc2cc(F)c([N+](=O)[O-])cc2F)n1 |
| InChI | InChI=1S/C11H7F2N5O3/c12-5-4-9(6(13)3-8(5)18(19)20)21-11-16-2-1-7(17-11)10(14)15/h1-4H,(H3,14,15) |
| InChIKey | WXJMXIKKYAEKDO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|