C14H10N4O — CID 107545976
2-(4-cyano-2,6-dimethylphenoxy)pyrimidine-4-carbonitrile (PubChem CID 107545976) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(4-cyano-2,6-dimethylphenoxy)pyrimidine-4-carbonitrile.
| Compound Name | 2-(4-cyano-2,6-dimethylphenoxy)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545976 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(4-cyano-2,6-dimethylphenoxy)pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nccc(C#N)n1 |
| InChI | InChI=1S/C14H10N4O/c1-9-5-11(7-15)6-10(2)13(9)19-14-17-4-3-12(8-16)18-14/h3-6H,1-2H3 |
| InChIKey | IANNSPHMSXZJFK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |