C13H10BrN3O — CID 107723258
2-(4-bromo-3,5-dimethylphenoxy)pyrimidine-4-carbonitrile (PubChem CID 107723258) has the molecular formula C13H10BrN3O and a molecular weight of 304.15 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)pyrimidine-4-carbonitrile.
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107723258 |
| Molecular Formula | C13H10BrN3O |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(Oc2nccc(C#N)n2)cc(C)c1Br |
| InChI | InChI=1S/C13H10BrN3O/c1-8-5-11(6-9(2)12(8)14)18-13-16-4-3-10(7-15)17-13/h3-6H,1-2H3 |
| InChIKey | IMBKKMPACDZGDY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |