C11H14N6S — CID 107547407
2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pyrimidine-4-carbothioamide (PubChem CID 107547407) has the molecular formula C11H14N6S and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547407 |
| Molecular Formula | C11H14N6S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pyrimidine-4-carbothioamide |
| SMILES | CN(Cc1nccn1C)c1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C11H14N6S/c1-16-6-5-13-9(16)7-17(2)11-14-4-3-8(15-11)10(12)18/h3-6H,7H2,1-2H3,(H2,12,18) |
| InChIKey | LIGAJRQPCWIFFA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|