C10H18N4S — CID 63015012
2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanethioamide (PubChem CID 63015012) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanethioamide.
| Compound Name | 2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanethioamide |
|---|---|
| PubChem CID | 63015012 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanethioamide |
| SMILES | CC(CN(C)Cc1nccn1C)C(N)=S |
| InChI | InChI=1S/C10H18N4S/c1-8(10(11)15)6-13(2)7-9-12-4-5-14(9)3/h4-5,8H,6-7H2,1-3H3,(H2,11,15) |
| InChIKey | GASBJZRLUZVNKV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|