C10H20N4O — CID 64792480
2-amino-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]butan-1-ol (PubChem CID 64792480) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-amino-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]butan-1-ol.
| Compound Name | 2-amino-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 64792480 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-amino-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]butan-1-ol |
| SMILES | CN(CCC(N)CO)Cc1nccn1C |
| InChI | InChI=1S/C10H20N4O/c1-13(5-3-9(11)8-15)7-10-12-4-6-14(10)2/h4,6,9,15H,3,5,7-8,11H2,1-2H3 |
| InChIKey | WKBSLRXILGREBE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |