C12H22ClN3 — CID 63026955
6-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]hexan-1-amine (PubChem CID 63026955) has the molecular formula C12H22ClN3 and a molecular weight of 243.78 g/mol. Its IUPAC name is 6-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]hexan-1-amine.
| Compound Name | 6-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 63026955 |
| Molecular Formula | C12H22ClN3 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 6-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]hexan-1-amine |
| SMILES | CN(CCCCCCCl)Cc1nccn1C |
| InChI | InChI=1S/C12H22ClN3/c1-15(9-6-4-3-5-7-13)11-12-14-8-10-16(12)2/h8,10H,3-7,9,11H2,1-2H3 |
| InChIKey | HARWRMCKPDIUHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|