C14H28N4 — CID 63025347
N-tert-butyl-N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine (PubChem CID 63025347) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N-tert-butyl-N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine.
| Compound Name | N-tert-butyl-N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 63025347 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N-tert-butyl-N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine |
| SMILES | CN(CCCCNC(C)(C)C)Cc1nccn1C |
| InChI | InChI=1S/C14H28N4/c1-14(2,3)16-8-6-7-10-17(4)12-13-15-9-11-18(13)5/h9,11,16H,6-8,10,12H2,1-5H3 |
| InChIKey | VIWHILCFZHAYPO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|