C11H22N4 — CID 63024435
N,N'-dimethyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine (PubChem CID 63024435) has the molecular formula C11H22N4 and a molecular weight of 210.33 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine.
| Compound Name | N,N'-dimethyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 63024435 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.33 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N,N'-dimethyl-N'-[(1-methylimidazol-2-yl)methyl]butane-1,4-diamine |
| SMILES | CNCCCCN(C)Cc1nccn1C |
| InChI | InChI=1S/C11H22N4/c1-12-6-4-5-8-14(2)10-11-13-7-9-15(11)3/h7,9,12H,4-6,8,10H2,1-3H3 |
| InChIKey | QJJHQHQGWZWAQQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|