C9H18N4O2S — CID 63026028
N-methyl-2-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]ethanesulfonamide (PubChem CID 63026028) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is N-methyl-2-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]ethanesulfonamide.
| Compound Name | N-methyl-2-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 63026028 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-methyl-2-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]ethanesulfonamide |
| SMILES | CNCCS(=O)(=O)N(C)Cc1nccn1C |
| InChI | InChI=1S/C9H18N4O2S/c1-10-5-7-16(14,15)13(3)8-9-11-4-6-12(9)2/h4,6,10H,5,7-8H2,1-3H3 |
| InChIKey | JBQMMDNGQDPUET-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |