C12H15BrN4O2S — CID 61140335
2-amino-4-bromo-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 61140335) has the molecular formula C12H15BrN4O2S and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-amino-4-bromo-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 61140335 |
| Molecular Formula | C12H15BrN4O2S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2-amino-4-bromo-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | CN(Cc1nccn1C)S(=O)(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C12H15BrN4O2S/c1-16-6-5-15-12(16)8-17(2)20(18,19)11-4-3-9(13)7-10(11)14/h3-7H,8,14H2,1-2H3 |
| InChIKey | YIJUNTVMISJZDS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|