C12H14F2N4O2S — CID 61141101
4-amino-2,6-difluoro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 61141101) has the molecular formula C12H14F2N4O2S and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-amino-2,6-difluoro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-difluoro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 61141101 |
| Molecular Formula | C12H14F2N4O2S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-amino-2,6-difluoro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | CN(Cc1nccn1C)S(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H14F2N4O2S/c1-17-4-3-16-11(17)7-18(2)21(19,20)12-9(13)5-8(15)6-10(12)14/h3-6H,7,15H2,1-2H3 |
| InChIKey | USQQSCSZLKUXGZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|