C14H26N4O2 — CID 63026662
methyl 2-amino-2-methyl-6-[methyl-[(1-methylimidazol-2-yl)methyl]amino]hexanoate (PubChem CID 63026662) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is methyl 2-amino-2-methyl-6-[methyl-[(1-methylimidazol-2-yl)methyl]amino]hexanoate.
| Compound Name | methyl 2-amino-2-methyl-6-[methyl-[(1-methylimidazol-2-yl)methyl]amino]hexanoate |
|---|---|
| PubChem CID | 63026662 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | methyl 2-amino-2-methyl-6-[methyl-[(1-methylimidazol-2-yl)methyl]amino]hexanoate |
| SMILES | COC(=O)C(C)(N)CCCCN(C)Cc1nccn1C |
| InChI | InChI=1S/C14H26N4O2/c1-14(15,13(19)20-4)7-5-6-9-17(2)11-12-16-8-10-18(12)3/h8,10H,5-7,9,11,15H2,1-4H3 |
| InChIKey | PHXYEIQXIGMFHR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|