C14H26N4O2 — CID 63024944
ethyl 2-(ethylamino)-2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate (PubChem CID 63024944) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is ethyl 2-(ethylamino)-2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate.
| Compound Name | ethyl 2-(ethylamino)-2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 63024944 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | ethyl 2-(ethylamino)-2-methyl-3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate |
| SMILES | CCNC(C)(CN(C)Cc1nccn1C)C(=O)OCC |
| InChI | InChI=1S/C14H26N4O2/c1-6-16-14(3,13(19)20-7-2)11-17(4)10-12-15-8-9-18(12)5/h8-9,16H,6-7,10-11H2,1-5H3 |
| InChIKey | OECJOUVIJCLZHA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |