C15H28N4O2 — CID 64704572
methyl 2-(ethylamino)-2-methyl-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pentanoate (PubChem CID 64704572) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is methyl 2-(ethylamino)-2-methyl-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pentanoate.
| Compound Name | methyl 2-(ethylamino)-2-methyl-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pentanoate |
|---|---|
| PubChem CID | 64704572 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | methyl 2-(ethylamino)-2-methyl-4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]pentanoate |
| SMILES | CCNC(C)(CC(C)N(C)Cc1nccn1C)C(=O)OC |
| InChI | InChI=1S/C15H28N4O2/c1-7-17-15(3,14(20)21-6)10-12(2)19(5)11-13-16-8-9-18(13)4/h8-9,12,17H,7,10-11H2,1-6H3 |
| InChIKey | XITCIRYPYWXNTQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |