C10H17N3O2 — CID 62011854
methyl 3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate (PubChem CID 62011854) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 62011854 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | methyl 3-[methyl-[(1-methylimidazol-2-yl)methyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)Cc1nccn1C |
| InChI | InChI=1S/C10H17N3O2/c1-12(6-4-10(14)15-3)8-9-11-5-7-13(9)2/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | IFENYVWPPFWJFV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |