C16H19ClN2 — CID 10754838
(E)-2-(1-benzylpyridin-1-ium-4-yl)-N,N-dimethylethenamine chloride (PubChem CID 10754838) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is (E)-2-(1-benzylpyridin-1-ium-4-yl)-N,N-dimethylethenamine chloride.
| Compound Name | (E)-2-(1-benzylpyridin-1-ium-4-yl)-N,N-dimethylethenamine chloride |
|---|---|
| PubChem CID | 10754838 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (E)-2-(1-benzylpyridin-1-ium-4-yl)-N,N-dimethylethenamine chloride |
| SMILES | CN(C)/C=C/c1cc[n+](Cc2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C16H19N2.ClH/c1-17(2)11-8-15-9-12-18(13-10-15)14-16-6-4-3-5-7-16;/h3-13H,14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MAFIABMEDLNDLC-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|