C11H11N3OS2 — CID 107548612
2-(2-thiophen-2-ylethoxy)pyrimidine-4-carbothioamide (PubChem CID 107548612) has the molecular formula C11H11N3OS2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylethoxy)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2-thiophen-2-ylethoxy)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548612 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-(2-thiophen-2-ylethoxy)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(OCCc2cccs2)n1 |
| InChI | InChI=1S/C11H11N3OS2/c12-10(16)9-3-5-13-11(14-9)15-6-4-8-2-1-7-17-8/h1-3,5,7H,4,6H2,(H2,12,16) |
| InChIKey | CZOKOSSRXFFCAM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|