C11H18N6 — CID 107550482
2-[3-(dimethylamino)pyrrolidin-1-yl]pyrimidine-4-carboximidamide (PubChem CID 107550482) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is 2-[3-(dimethylamino)pyrrolidin-1-yl]pyrimidine-4-carboximidamide.
| Compound Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550482 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(N2CCC(N(C)C)C2)n1 |
| InChI | InChI=1S/C11H18N6/c1-16(2)8-4-6-17(7-8)11-14-5-3-9(15-11)10(12)13/h3,5,8H,4,6-7H2,1-2H3,(H3,12,13) |
| InChIKey | MEYPCGAYTAMWEL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|