C15H25N5 — CID 107550546
2-(4-tert-butylazepan-1-yl)pyrimidine-4-carboximidamide (PubChem CID 107550546) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-(4-tert-butylazepan-1-yl)pyrimidine-4-carboximidamide.
| Compound Name | 2-(4-tert-butylazepan-1-yl)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550546 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-(4-tert-butylazepan-1-yl)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(N2CCCC(C(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C15H25N5/c1-15(2,3)11-5-4-9-20(10-7-11)14-18-8-6-12(19-14)13(16)17/h6,8,11H,4-5,7,9-10H2,1-3H3,(H3,16,17) |
| InChIKey | IOUSUKFSHQZMJO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|