C14H19N5 — CID 107552401
2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107552401) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107552401 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(N2C[C@H]3CCC(N)C[C@H]3C2)n1 |
| InChI | InChI=1S/C14H19N5/c1-9-4-13(6-15)18-14(17-9)19-7-10-2-3-12(16)5-11(10)8-19/h4,10-12H,2-3,5,7-8,16H2,1H3/t10-,11+,12?/m1/s1 |
| InChIKey | HDBOTWQNGWDXTI-UBNQGINQSA-N |
| XLogP | 1.22 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |