C16H24N4O — CID 43599526
2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4,6-dimethylpyridine-3-carboxamide (PubChem CID 43599526) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 43599526 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(N)=O)c(N2C[C@H]3CCC(N)C[C@H]3C2)n1 |
| InChI | InChI=1S/C16H24N4O/c1-9-5-10(2)19-16(14(9)15(18)21)20-7-11-3-4-13(17)6-12(11)8-20/h5,11-13H,3-4,6-8,17H2,1-2H3,(H2,18,21)/t11-,12+,13?/m1/s1 |
| InChIKey | LRMQBLFKNSOQKS-OJRHAOMCSA-N |
| XLogP | 1.36 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |