C10H13N5 — CID 107552495
2-[(2-aminocyclopentyl)amino]pyrimidine-4-carbonitrile (PubChem CID 107552495) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-[(2-aminocyclopentyl)amino]pyrimidine-4-carbonitrile.
| Compound Name | 2-[(2-aminocyclopentyl)amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107552495 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-[(2-aminocyclopentyl)amino]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC2CCCC2N)n1 |
| InChI | InChI=1S/C10H13N5/c11-6-7-4-5-13-10(14-7)15-9-3-1-2-8(9)12/h4-5,8-9H,1-3,12H2,(H,13,14,15) |
| InChIKey | GLUIFIKTFZZVQN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |