C12H12BrN3O2S — CID 107553737
2-[(4-bromothiophen-2-yl)methyl-methylamino]-6-methylpyrimidine-4-carboxylic acid (PubChem CID 107553737) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl-methylamino]-6-methylpyrimidine-4-carboxylic acid.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl-methylamino]-6-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107553737 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl-methylamino]-6-methylpyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nc(N(C)Cc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C12H12BrN3O2S/c1-7-3-10(11(17)18)15-12(14-7)16(2)5-9-4-8(13)6-19-9/h3-4,6H,5H2,1-2H3,(H,17,18) |
| InChIKey | IXZUNVYGZYISIM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |