C12H14BrN3OS — CID 83183767
[2-[(4-bromothiophen-2-yl)methyl-methylamino]-4-methylpyrimidin-5-yl]methanol (PubChem CID 83183767) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is [2-[(4-bromothiophen-2-yl)methyl-methylamino]-4-methylpyrimidin-5-yl]methanol.
| Compound Name | [2-[(4-bromothiophen-2-yl)methyl-methylamino]-4-methylpyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 83183767 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | [2-[(4-bromothiophen-2-yl)methyl-methylamino]-4-methylpyrimidin-5-yl]methanol |
| SMILES | Cc1nc(N(C)Cc2cc(Br)cs2)ncc1CO |
| InChI | InChI=1S/C12H14BrN3OS/c1-8-9(6-17)4-14-12(15-8)16(2)5-11-3-10(13)7-18-11/h3-4,7,17H,5-6H2,1-2H3 |
| InChIKey | RVDQGROXKIFMEE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |