C10H6BrF3N2OS — CID 114204991
[2-(4-bromothiophen-2-yl)-4-(trifluoromethyl)pyrimidin-5-yl]methanol (PubChem CID 114204991) has the molecular formula C10H6BrF3N2OS and a molecular weight of 339.14 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-4-(trifluoromethyl)pyrimidin-5-yl]methanol.
| Compound Name | [2-(4-bromothiophen-2-yl)-4-(trifluoromethyl)pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 114204991 |
| Molecular Formula | C10H6BrF3N2OS |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-4-(trifluoromethyl)pyrimidin-5-yl]methanol |
| SMILES | OCc1cnc(-c2cc(Br)cs2)nc1C(F)(F)F |
| InChI | InChI=1S/C10H6BrF3N2OS/c11-6-1-7(18-4-6)9-15-2-5(3-17)8(16-9)10(12,13)14/h1-2,4,17H,3H2 |
| InChIKey | MJMPCANRZAKAMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |