C13H11N3O5 — CID 107554847
2-(2,4-dimethyl-6-nitrophenoxy)pyrimidine-4-carboxylic acid (PubChem CID 107554847) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-nitrophenoxy)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(2,4-dimethyl-6-nitrophenoxy)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107554847 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(2,4-dimethyl-6-nitrophenoxy)pyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C)c(Oc2nccc(C(=O)O)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N3O5/c1-7-5-8(2)11(10(6-7)16(19)20)21-13-14-4-3-9(15-13)12(17)18/h3-6H,1-2H3,(H,17,18) |
| InChIKey | ZCTIMCNHECVAIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|