C7H6F2N2O3 — CID 107555001
2-(2,2-difluoroethoxy)pyrimidine-4-carboxylic acid (PubChem CID 107555001) has the molecular formula C7H6F2N2O3 and a molecular weight of 204.13 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(2,2-difluoroethoxy)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107555001 |
| Molecular Formula | C7H6F2N2O3 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-(2,2-difluoroethoxy)pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(OCC(F)F)n1 |
| InChI | InChI=1S/C7H6F2N2O3/c8-5(9)3-14-7-10-2-1-4(11-7)6(12)13/h1-2,5H,3H2,(H,12,13) |
| InChIKey | FMYHNURYUBNXAV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |