C11H16N2O4 — CID 107555073
2-(3-methoxy-3-methylbutoxy)pyrimidine-4-carboxylic acid (PubChem CID 107555073) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(3-methoxy-3-methylbutoxy)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(3-methoxy-3-methylbutoxy)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107555073 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(3-methoxy-3-methylbutoxy)pyrimidine-4-carboxylic acid |
| SMILES | COC(C)(C)CCOc1nccc(C(=O)O)n1 |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,16-3)5-7-17-10-12-6-4-8(13-10)9(14)15/h4,6H,5,7H2,1-3H3,(H,14,15) |
| InChIKey | NDINMUMLERLTNO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |