C12H18N2O4 — CID 106665179
2-(3-methoxy-3-methylbutoxy)-4-methylpyrimidine-5-carboxylic acid (PubChem CID 106665179) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(3-methoxy-3-methylbutoxy)-4-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(3-methoxy-3-methylbutoxy)-4-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 106665179 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(3-methoxy-3-methylbutoxy)-4-methylpyrimidine-5-carboxylic acid |
| SMILES | COC(C)(C)CCOc1ncc(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C12H18N2O4/c1-8-9(10(15)16)7-13-11(14-8)18-6-5-12(2,3)17-4/h7H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | PINPMJXDYYXUSF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |