C16H27N3S — CID 107555391
N-[[5-[(4-cyclopropylpiperazin-1-yl)methyl]thiophen-2-yl]methyl]propan-2-amine (PubChem CID 107555391) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is N-[[5-[(4-cyclopropylpiperazin-1-yl)methyl]thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-[(4-cyclopropylpiperazin-1-yl)methyl]thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107555391 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[[5-[(4-cyclopropylpiperazin-1-yl)methyl]thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(CN2CCN(C3CC3)CC2)s1 |
| InChI | InChI=1S/C16H27N3S/c1-13(2)17-11-15-5-6-16(20-15)12-18-7-9-19(10-8-18)14-3-4-14/h5-6,13-14,17H,3-4,7-12H2,1-2H3 |
| InChIKey | BRRUQBJONOZNOS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |