C17H29N3S — CID 107556740
N-[[5-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)thiophen-2-yl]methyl]propan-2-amine (PubChem CID 107556740) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is N-[[5-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107556740 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-[[5-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(CN2CCCN3CCCC3C2)s1 |
| InChI | InChI=1S/C17H29N3S/c1-14(2)18-11-16-6-7-17(21-16)13-19-8-4-10-20-9-3-5-15(20)12-19/h6-7,14-15,18H,3-5,8-13H2,1-2H3 |
| InChIKey | BWCIQLGIAMJLMG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |