C13H16F3N3S — CID 107557845
N-[[5-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methyl]propan-2-amine (PubChem CID 107557845) has the molecular formula C13H16F3N3S and a molecular weight of 303.35 g/mol. Its IUPAC name is N-[[5-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107557845 |
| Molecular Formula | C13H16F3N3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[[5-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(Cn2cc(C(F)(F)F)cn2)s1 |
| InChI | InChI=1S/C13H16F3N3S/c1-9(2)17-6-11-3-4-12(20-11)8-19-7-10(5-18-19)13(14,15)16/h3-5,7,9,17H,6,8H2,1-2H3 |
| InChIKey | SVBJVFXLGJPRLU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |