C18H13FN2O — CID 10756047
[1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol (PubChem CID 10756047) has the molecular formula C18H13FN2O and a molecular weight of 292.31 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol.
| Compound Name | [1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol |
|---|---|
| PubChem CID | 10756047 |
| Molecular Formula | C18H13FN2O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol |
| SMILES | OCc1cc2c([nH]c3ccccc32)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H13FN2O/c19-12-7-5-11(6-8-12)17-18-15(9-13(10-22)20-17)14-3-1-2-4-16(14)21-18/h1-9,21-22H,10H2 |
| InChIKey | VINDFRGJOHTMOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |