C14H12ClF3N2 — CID 107561604
(3-chloro-4-methylphenyl)-[5-(trifluoromethyl)-2-pyridinyl]methanamine (PubChem CID 107561604) has the molecular formula C14H12ClF3N2 and a molecular weight of 300.71 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-[5-(trifluoromethyl)-2-pyridinyl]methanamine.
| Compound Name | (3-chloro-4-methylphenyl)-[5-(trifluoromethyl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 107561604 |
| Molecular Formula | C14H12ClF3N2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (3-chloro-4-methylphenyl)-[5-(trifluoromethyl)-2-pyridinyl]methanamine |
| SMILES | Cc1ccc(C(N)c2ccc(C(F)(F)F)cn2)cc1Cl |
| InChI | InChI=1S/C14H12ClF3N2/c1-8-2-3-9(6-11(8)15)13(19)12-5-4-10(7-20-12)14(16,17)18/h2-7,13H,19H2,1H3 |
| InChIKey | ZEKWSEHBYAFRSF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |